About 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate
10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate (PubChem CID 158921584) has the molecular formula C34H37NO4S
and a molecular weight of 555.74 g/mol. Its IUPAC name is 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate |
| PubChem CID | 158921584 |
| Molecular Formula | C34H37NO4S |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate |
| SMILES | CCCCC(CC)CO[n+]1c2ccccc2c(-c2ccccc2)c2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C27H30NO.C7H8O3S/c1-3-5-13-21(4-2)20-29-28-25-18-11-9-16-23(25)27(22-14-7-6-8-15-22)24-17-10-12-19-26(24)28;1-6-2-4-7(5-3-6)11(8,9)10/h6-12,14-19,21H,3-5,13,20H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | FIWCIOKHICVDPK-UHFFFAOYSA-M |
| XLogP | 7.49 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate?
The IUPAC name of 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate (CID 158921584) is 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate.
What is the SMILES notation for 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate?
The canonical SMILES for 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate is CCCCC(CC)CO[n+]1c2ccccc2c(-c2ccccc2)c2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate?
The InChIKey is FIWCIOKHICVDPK-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H30NO.C7H8O3S/c1-3-5-13-21(4-2)20-29-28-25-18-11-9-16-23(25)27(22-14-7-6-8-15-22)24-17-10-12-19-26(24)28;1-6-2-4-7(5-3-6)11(8,9)10/h6-12,14-19,21H,3-5,13,20H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate?
10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate has a molecular weight of 555.74 g/mol, XLogP of 7.49, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-ethylhexoxy)-9-phenylacridin-10-ium;4-methylbenzenesulfonate is sourced from PubChem (CID 158921584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).