C28H38N2O4S — CID 161393974
4-[1-(2-ethylhexoxy)pyridin-1-ium-4-yl]-N,N-dimethylaniline;4-methylbenzenesulfonate (PubChem CID 161393974) has the molecular formula C28H38N2O4S and a molecular weight of 498.69 g/mol. Its IUPAC name is 4-[1-(2-ethylhexoxy)pyridin-1-ium-4-yl]-N,N-dimethylaniline;4-methylbenzenesulfonate.
| Compound Name | 4-[1-(2-ethylhexoxy)pyridin-1-ium-4-yl]-N,N-dimethylaniline;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 161393974 |
| Molecular Formula | C28H38N2O4S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 4-[1-(2-ethylhexoxy)pyridin-1-ium-4-yl]-N,N-dimethylaniline;4-methylbenzenesulfonate |
| SMILES | CCCCC(CC)CO[n+]1ccc(-c2ccc(N(C)C)cc2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C21H31N2O.C7H8O3S/c1-5-7-8-18(6-2)17-24-23-15-13-20(14-16-23)19-9-11-21(12-10-19)22(3)4;1-6-2-4-7(5-3-6)11(8,9)10/h9-16,18H,5-8,17H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | RCNDXVDLLBLNMF-UHFFFAOYSA-M |
| XLogP | 5.25 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|