About distrontium;1-methoxypropan-1-olate;propan-2-olate
distrontium;1-methoxypropan-1-olate;propan-2-olate (PubChem CID 158924035) has the molecular formula C7H16O3Sr2+2
and a molecular weight of 323.44 g/mol. Its IUPAC name is distrontium;1-methoxypropan-1-olate;propan-2-olate.
Molecular Properties
| Compound Name | distrontium;1-methoxypropan-1-olate;propan-2-olate |
| PubChem CID | 158924035 |
| Molecular Formula | C7H16O3Sr2+2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | distrontium;1-methoxypropan-1-olate;propan-2-olate |
| SMILES | CC(C)[O-].CCC([O-])OC.[Sr+2].[Sr+2] |
| InChI | InChI=1S/C4H9O2.C3H7O.2Sr/c1-3-4(5)6-2;1-3(2)4;;/h4H,3H2,1-2H3;3H,1-2H3;;/q2*-1;2*+2 |
| InChIKey | JIEXBZMKOBDZOZ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze distrontium;1-methoxypropan-1-olate;propan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of distrontium;1-methoxypropan-1-olate;propan-2-olate?
The IUPAC name of distrontium;1-methoxypropan-1-olate;propan-2-olate (CID 158924035) is distrontium;1-methoxypropan-1-olate;propan-2-olate.
What is the SMILES notation for distrontium;1-methoxypropan-1-olate;propan-2-olate?
The canonical SMILES for distrontium;1-methoxypropan-1-olate;propan-2-olate is CC(C)[O-].CCC([O-])OC.[Sr+2].[Sr+2].
What is the InChIKey of distrontium;1-methoxypropan-1-olate;propan-2-olate?
The InChIKey is JIEXBZMKOBDZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O2.C3H7O.2Sr/c1-3-4(5)6-2;1-3(2)4;;/h4H,3H2,1-2H3;3H,1-2H3;;/q2*-1;2*+2.
What are the key properties of distrontium;1-methoxypropan-1-olate;propan-2-olate?
distrontium;1-methoxypropan-1-olate;propan-2-olate has a molecular weight of 323.44 g/mol, XLogP of -1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for distrontium;1-methoxypropan-1-olate;propan-2-olate is sourced from PubChem (CID 158924035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).