C14H22O — CID 15892525
2-butyl-3,4-bis(prop-2-enyl)-2,5-dihydrofuran (PubChem CID 15892525) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-butyl-3,4-bis(prop-2-enyl)-2,5-dihydrofuran.
| Compound Name | 2-butyl-3,4-bis(prop-2-enyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 15892525 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-butyl-3,4-bis(prop-2-enyl)-2,5-dihydrofuran |
| SMILES | C=CCC1=C(CC=C)C(CCCC)OC1 |
| InChI | InChI=1S/C14H22O/c1-4-7-10-14-13(9-6-3)12(8-5-2)11-15-14/h5-6,14H,2-4,7-11H2,1H3 |
| InChIKey | WGRZFCJUSIJCMN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|