C18H15BrCl4O4 — CID 158928110
1-(3-bromo-2,5-dichloro-6-methoxyphenyl)ethanone;1-(3,6-dichloro-2-methoxyphenyl)ethanone (PubChem CID 158928110) has the molecular formula C18H15BrCl4O4 and a molecular weight of 517.03 g/mol. Its IUPAC name is 1-(3-bromo-2,5-dichloro-6-methoxyphenyl)ethanone;1-(3,6-dichloro-2-methoxyphenyl)ethanone.
| Compound Name | 1-(3-bromo-2,5-dichloro-6-methoxyphenyl)ethanone;1-(3,6-dichloro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 158928110 |
| Molecular Formula | C18H15BrCl4O4 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 513.89 |
| IUPAC Name | 1-(3-bromo-2,5-dichloro-6-methoxyphenyl)ethanone;1-(3,6-dichloro-2-methoxyphenyl)ethanone |
| SMILES | COc1c(Cl)cc(Br)c(Cl)c1C(C)=O.COc1c(Cl)ccc(Cl)c1C(C)=O |
| InChI | InChI=1S/C9H7BrCl2O2.C9H8Cl2O2/c1-4(13)7-8(12)5(10)3-6(11)9(7)14-2;1-5(12)8-6(10)3-4-7(11)9(8)13-2/h3H,1-2H3;3-4H,1-2H3 |
| InChIKey | JIRSLDOBHPKMMC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|