C33H51Cl2N3O7 — CID 158934836
tert-butyl 7-[2-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,6-dioxoundec-10-enoate (PubChem CID 158934836) has the molecular formula C33H51Cl2N3O7 and a molecular weight of 672.69 g/mol. Its IUPAC name is tert-butyl 7-[2-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,6-dioxoundec-10-enoate.
| Compound Name | tert-butyl 7-[2-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,6-dioxoundec-10-enoate |
|---|---|
| PubChem CID | 158934836 |
| Molecular Formula | C33H51Cl2N3O7 |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | tert-butyl 7-[2-[(1S,2S,5R)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dichloro-3-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]-5,6-dioxoundec-10-enoate |
| SMILES | C=CCCC(CC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)NC(C)(C)C)C(C)(C)C)C2(Cl)Cl)C(=O)C(=O)CCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H51Cl2N3O7/c1-11-12-14-19(26(42)21(39)15-13-16-23(41)45-32(8,9)10)17-22(40)25-24-20(33(24,34)35)18-38(25)28(43)27(30(2,3)4)36-29(44)37-31(5,6)7/h11,19-20,24-25,27H,1,12-18H2,2-10H3,(H2,36,37,44)/t19?,20-,24-,25+,27+/m0/s1 |
| InChIKey | PHCWINMGPAQBPH-BEGUVSRSSA-N |
| XLogP | 5.32 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|