About 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane
1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane (PubChem CID 158937416) has the molecular formula C34H52O
and a molecular weight of 476.79 g/mol. Its IUPAC name is 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane.
Molecular Properties
| Compound Name | 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane |
| PubChem CID | 158937416 |
| Molecular Formula | C34H52O |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.40 |
| IUPAC Name | 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane |
| SMILES | CC.CCCCCCCCCCCC(C)(C)OC.c1ccc(Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C17H14.C15H32O.C2H6/c1-2-7-14(8-3-1)13-16-11-6-10-15-9-4-5-12-17(15)16;1-5-6-7-8-9-10-11-12-13-14-15(2,3)16-4;1-2/h1-12H,13H2;5-14H2,1-4H3;1-2H3 |
| InChIKey | JJVAZPRKPRFRAF-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane?
The IUPAC name of 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane (CID 158937416) is 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane.
What is the SMILES notation for 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane?
The canonical SMILES for 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane is CC.CCCCCCCCCCCC(C)(C)OC.c1ccc(Cc2cccc3ccccc23)cc1.
What is the InChIKey of 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane?
The InChIKey is JJVAZPRKPRFRAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14.C15H32O.C2H6/c1-2-7-14(8-3-1)13-16-11-6-10-15-9-4-5-12-17(15)16;1-5-6-7-8-9-10-11-12-13-14-15(2,3)16-4;1-2/h1-12H,13H2;5-14H2,1-4H3;1-2H3.
What are the key properties of 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane?
1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane has a molecular weight of 476.79 g/mol, XLogP of 10.79, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylnaphthalene;ethane;2-methoxy-2-methyltridecane is sourced from PubChem (CID 158937416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).