About isocyanomethanedithioate;tetraethylazanium
isocyanomethanedithioate;tetraethylazanium (PubChem CID 158938812) has the molecular formula C10H20N2S2
and a molecular weight of 232.42 g/mol. Its IUPAC name is isocyanomethanedithioate;tetraethylazanium.
Molecular Properties
| Compound Name | isocyanomethanedithioate;tetraethylazanium |
| PubChem CID | 158938812 |
| Molecular Formula | C10H20N2S2 |
| Molecular Weight | 232.42 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | isocyanomethanedithioate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.[C-]#[N+]C(=S)[S-] |
| InChI | InChI=1S/C8H20N.C2HNS2/c1-5-9(6-2,7-3)8-4;1-3-2(4)5/h5-8H2,1-4H3;(H,4,5)/q+1;/p-1 |
| InChIKey | YIKYWKZHHLISJR-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze isocyanomethanedithioate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanomethanedithioate;tetraethylazanium?
The IUPAC name of isocyanomethanedithioate;tetraethylazanium (CID 158938812) is isocyanomethanedithioate;tetraethylazanium.
What is the SMILES notation for isocyanomethanedithioate;tetraethylazanium?
The canonical SMILES for isocyanomethanedithioate;tetraethylazanium is CC[N+](CC)(CC)CC.[C-]#[N+]C(=S)[S-].
What is the InChIKey of isocyanomethanedithioate;tetraethylazanium?
The InChIKey is YIKYWKZHHLISJR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C2HNS2/c1-5-9(6-2,7-3)8-4;1-3-2(4)5/h5-8H2,1-4H3;(H,4,5)/q+1;/p-1.
What are the key properties of isocyanomethanedithioate;tetraethylazanium?
isocyanomethanedithioate;tetraethylazanium has a molecular weight of 232.42 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanomethanedithioate;tetraethylazanium is sourced from PubChem (CID 158938812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).