C37H67N5O12 — CID 158941725
tert-butyl 4-[3-[5-[[10-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-3-oxopropoxy]butanoate (PubChem CID 158941725) has the molecular formula C37H67N5O12 and a molecular weight of 773.97 g/mol. Its IUPAC name is tert-butyl 4-[3-[5-[[10-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-3-oxopropoxy]butanoate.
| Compound Name | tert-butyl 4-[3-[5-[[10-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-3-oxopropoxy]butanoate |
|---|---|
| PubChem CID | 158941725 |
| Molecular Formula | C37H67N5O12 |
| Molecular Weight | 773.97 g/mol |
| Exact Mass | 773.48 |
| IUPAC Name | tert-butyl 4-[3-[5-[[10-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-3-oxopropoxy]butanoate |
| SMILES | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCCC(=O)CCC(=O)N(O)CCCCCNC(=O)CCOCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H67N5O12/c1-30(43)40(50)25-13-7-10-23-38-32(45)19-21-35(48)42(52)26-12-6-5-9-16-31(44)18-20-34(47)41(51)27-14-8-11-24-39-33(46)22-29-53-28-15-17-36(49)54-37(2,3)4/h50-52H,5-29H2,1-4H3,(H,38,45)(H,39,46) |
| InChIKey | JKIGVBQULIOFLR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 232.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|