C40H32O3 — CID 158945821
5-methylacenaphthylene-1,2-dione;6-methyl-2H-acenaphthylen-1-one;4-methyl-2,3-dihydro-1H-cyclopenta[b]naphthalene (PubChem CID 158945821) has the molecular formula C40H32O3 and a molecular weight of 560.69 g/mol. Its IUPAC name is 5-methylacenaphthylene-1,2-dione;6-methyl-2H-acenaphthylen-1-one;4-methyl-2,3-dihydro-1H-cyclopenta[b]naphthalene.
| Compound Name | 5-methylacenaphthylene-1,2-dione;6-methyl-2H-acenaphthylen-1-one;4-methyl-2,3-dihydro-1H-cyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 158945821 |
| Molecular Formula | C40H32O3 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 5-methylacenaphthylene-1,2-dione;6-methyl-2H-acenaphthylen-1-one;4-methyl-2,3-dihydro-1H-cyclopenta[b]naphthalene |
| SMILES | Cc1c2c(cc3ccccc13)CCC2.Cc1ccc2c3c(cccc13)C(=O)C2=O.Cc1ccc2c3c(cccc13)CC2=O |
| InChI | InChI=1S/C14H14.C13H8O2.C13H10O/c1-10-13-7-3-2-5-11(13)9-12-6-4-8-14(10)12;1-7-5-6-10-11-8(7)3-2-4-9(11)12(14)13(10)15;1-8-5-6-11-12(14)7-9-3-2-4-10(8)13(9)11/h2-3,5,7,9H,4,6,8H2,1H3;2-6H,1H3;2-6H,7H2,1H3 |
| InChIKey | JKUQYAISUPYQID-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|