C7H7NO6 — CID 158946932
2,6-dioxaspiro[3.3]heptane-1,3,5,7-tetrone;ethanamine (PubChem CID 158946932) has the molecular formula C7H7NO6 and a molecular weight of 201.13 g/mol. Its IUPAC name is 2,6-dioxaspiro[3.3]heptane-1,3,5,7-tetrone;ethanamine.
| Compound Name | 2,6-dioxaspiro[3.3]heptane-1,3,5,7-tetrone;ethanamine |
|---|---|
| PubChem CID | 158946932 |
| Molecular Formula | C7H7NO6 |
| Molecular Weight | 201.13 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 2,6-dioxaspiro[3.3]heptane-1,3,5,7-tetrone;ethanamine |
| SMILES | CCN.O=C1OC(=O)C12C(=O)OC2=O |
| InChI | InChI=1S/C5O6.C2H7N/c6-1-5(2(7)10-1)3(8)11-4(5)9;1-2-3/h;2-3H2,1H3 |
| InChIKey | JKXZILKBHNUVFD-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.13 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|