C28H22N6O — CID 158950267
benzene-1,2-diamine;benzimidazolo[2,1-a][2,7]naphthyridine;4-ethynylpyridine-3-carbaldehyde (PubChem CID 158950267) has the molecular formula C28H22N6O and a molecular weight of 458.53 g/mol. Its IUPAC name is benzene-1,2-diamine;benzimidazolo[2,1-a][2,7]naphthyridine;4-ethynylpyridine-3-carbaldehyde.
| Compound Name | benzene-1,2-diamine;benzimidazolo[2,1-a][2,7]naphthyridine;4-ethynylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 158950267 |
| Molecular Formula | C28H22N6O |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | benzene-1,2-diamine;benzimidazolo[2,1-a][2,7]naphthyridine;4-ethynylpyridine-3-carbaldehyde |
| SMILES | C#Cc1ccncc1C=O.Nc1ccccc1N.c1ccc2c(c1)nc1c3cnccc3ccn21 |
| InChI | InChI=1S/C14H9N3.C8H5NO.C6H8N2/c1-2-4-13-12(3-1)16-14-11-9-15-7-5-10(11)6-8-17(13)14;1-2-7-3-4-9-5-8(7)6-10;7-5-3-1-2-4-6(5)8/h1-9H;1,3-6H;1-4H,7-8H2 |
| InChIKey | JLIGOULZDHDPJX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|