C18H21NO4S — CID 15895382
4-[(naphthalen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxylic acid (PubChem CID 15895382) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-[(naphthalen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(naphthalen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 15895382 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[(naphthalen-2-ylsulfonylamino)methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@@H](CNS(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C18H21NO4S/c20-18(21)15-7-5-13(6-8-15)12-19-24(22,23)17-10-9-14-3-1-2-4-16(14)11-17/h1-4,9-11,13,15,19H,5-8,12H2,(H,20,21)/t13-,15+ |
| InChIKey | HQWIIBCOKWZXLP-OTVXOJSOSA-N |
| XLogP | 3.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |