C32H58O9Si — CID 158954035
(3aR,5S,6aR)-5-butyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;3-[(2S,3R,5S)-5-butyl-3-hydroxyoxolan-2-yl]prop-1-enyl acetate;1-trimethylsilylprop-2-enyl acetate (PubChem CID 158954035) has the molecular formula C32H58O9Si and a molecular weight of 614.89 g/mol. Its IUPAC name is (3aR,5S,6aR)-5-butyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;3-[(2S,3R,5S)-5-butyl-3-hydroxyoxolan-2-yl]prop-1-enyl acetate;1-trimethylsilylprop-2-enyl acetate.
| Compound Name | (3aR,5S,6aR)-5-butyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;3-[(2S,3R,5S)-5-butyl-3-hydroxyoxolan-2-yl]prop-1-enyl acetate;1-trimethylsilylprop-2-enyl acetate |
|---|---|
| PubChem CID | 158954035 |
| Molecular Formula | C32H58O9Si |
| Molecular Weight | 614.89 g/mol |
| Exact Mass | 614.39 |
| IUPAC Name | (3aR,5S,6aR)-5-butyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;3-[(2S,3R,5S)-5-butyl-3-hydroxyoxolan-2-yl]prop-1-enyl acetate;1-trimethylsilylprop-2-enyl acetate |
| SMILES | C=CC(OC(C)=O)[Si](C)(C)C.CCCC[C@H]1C[C@@H](O)[C@H](CC=COC(C)=O)O1.CCCC[C@H]1C[C@H]2OC(C)(C)O[C@H]2O1 |
| InChI | InChI=1S/C13H22O4.C11H20O3.C8H16O2Si/c1-3-4-6-11-9-12(15)13(17-11)7-5-8-16-10(2)14;1-4-5-6-8-7-9-10(12-8)14-11(2,3)13-9;1-6-8(10-7(2)9)11(3,4)5/h5,8,11-13,15H,3-4,6-7,9H2,1-2H3;8-10H,4-7H2,1-3H3;6,8H,1H2,2-5H3/t11-,12+,13-;8-,9+,10+;/m00./s1 |
| InChIKey | JLUCFUYSITWIPR-OLUASXQMSA-N |
| XLogP | 6.59 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.89 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|