C15H26O7 — CID 11758949
(2R,3R,5S,6R)-2-[2-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-6-methoxyoxane-3,5-diol (PubChem CID 11758949) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R,3R,5S,6R)-2-[2-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-6-methoxyoxane-3,5-diol.
| Compound Name | (2R,3R,5S,6R)-2-[2-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-6-methoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 11758949 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2R,3R,5S,6R)-2-[2-[(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl]-6-methoxyoxane-3,5-diol |
| SMILES | CO[C@@H]1O[C@H](CC[C@@H]2C[C@H]3OC(C)(C)O[C@H]3O2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C15H26O7/c1-15(2)21-12-6-8(19-14(12)22-15)4-5-11-9(16)7-10(17)13(18-3)20-11/h8-14,16-17H,4-7H2,1-3H3/t8-,9-,10+,11-,12-,13-,14-/m1/s1 |
| InChIKey | HIVHIJQMEAHCOJ-JANNVIMPSA-N |
| XLogP | 0.52 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |