C24H42N2O7S2 — CID 158958366
tert-butyl (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(phenylmethoxycarbonylamino)propoxy]butanoate;sulfane (PubChem CID 158958366) has the molecular formula C24H42N2O7S2 and a molecular weight of 534.74 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(phenylmethoxycarbonylamino)propoxy]butanoate;sulfane.
| Compound Name | tert-butyl (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(phenylmethoxycarbonylamino)propoxy]butanoate;sulfane |
|---|---|
| PubChem CID | 158958366 |
| Molecular Formula | C24H42N2O7S2 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | tert-butyl (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(phenylmethoxycarbonylamino)propoxy]butanoate;sulfane |
| SMILES | C[C@H](OCCCNC(=O)OCc1ccccc1)[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C.S.S |
| InChI | InChI=1S/C24H38N2O7.2H2S/c1-17(19(20(27)32-23(2,3)4)26-22(29)33-24(5,6)7)30-15-11-14-25-21(28)31-16-18-12-9-8-10-13-18;;/h8-10,12-13,17,19H,11,14-16H2,1-7H3,(H,25,28)(H,26,29);2*1H2/t17-,19-;;/m0../s1 |
| InChIKey | JMHMAXLPZSKACD-FFUVTKDNSA-N |
| XLogP | 4.17 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|