C4H9N3 — CID 158965440
1,3-dimethylideneguanidine;methane (PubChem CID 158965440) has the molecular formula C4H9N3 and a molecular weight of 99.14 g/mol. Its IUPAC name is 1,3-dimethylideneguanidine;methane.
| Compound Name | 1,3-dimethylideneguanidine;methane |
|---|---|
| PubChem CID | 158965440 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 1,3-dimethylideneguanidine;methane |
| SMILES | C.[H]N=C(N=C)N=C |
| InChI | InChI=1S/C3H5N3.CH4/c1-5-3(4)6-2;/h4H,1-2H2;1H4 |
| InChIKey | JNDIFKDQJSEAEK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|