About 1,3-dimethylideneguanidine;methane
1,3-dimethylideneguanidine;methane (PubChem CID 158965440) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is 1,3-dimethylideneguanidine;methane.
Molecular Properties
| Compound Name | 1,3-dimethylideneguanidine;methane |
| PubChem CID | 158965440 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 1,3-dimethylideneguanidine;methane |
| SMILES | C.[H]N=C(N=C)N=C |
| InChI | InChI=1S/C3H5N3.CH4/c1-5-3(4)6-2;/h4H,1-2H2;1H4 |
| InChIKey | JNDIFKDQJSEAEK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylideneguanidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylideneguanidine;methane?
The IUPAC name of 1,3-dimethylideneguanidine;methane (CID 158965440) is 1,3-dimethylideneguanidine;methane.
What is the SMILES notation for 1,3-dimethylideneguanidine;methane?
The canonical SMILES for 1,3-dimethylideneguanidine;methane is C.[H]N=C(N=C)N=C.
What is the InChIKey of 1,3-dimethylideneguanidine;methane?
The InChIKey is JNDIFKDQJSEAEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3.CH4/c1-5-3(4)6-2;/h4H,1-2H2;1H4.
What are the key properties of 1,3-dimethylideneguanidine;methane?
1,3-dimethylideneguanidine;methane has a molecular weight of 99.14 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylideneguanidine;methane is sourced from PubChem (CID 158965440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).