C6H8N4 — CID 139820201
N-[1,2,2-tris(methylideneamino)ethenyl]methanimine (PubChem CID 139820201) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is N-[1,2,2-tris(methylideneamino)ethenyl]methanimine.
| Compound Name | N-[1,2,2-tris(methylideneamino)ethenyl]methanimine |
|---|---|
| PubChem CID | 139820201 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | N-[1,2,2-tris(methylideneamino)ethenyl]methanimine |
| SMILES | C=NC(N=C)=C(N=C)N=C |
| InChI | InChI=1S/C6H8N4/c1-7-5(8-2)6(9-3)10-4/h1-4H2 |
| InChIKey | KKQOCWBHQHTXBO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|