C24H24N2O2 — CID 87602276
N,N',2,3,4,5,6,7,8,9,10,11-dodecamethylidenedodecanediamide (PubChem CID 87602276) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N,N',2,3,4,5,6,7,8,9,10,11-dodecamethylidenedodecanediamide.
| Compound Name | N,N',2,3,4,5,6,7,8,9,10,11-dodecamethylidenedodecanediamide |
|---|---|
| PubChem CID | 87602276 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N,N',2,3,4,5,6,7,8,9,10,11-dodecamethylidenedodecanediamide |
| SMILES | C=NC(=O)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=O)N=C |
| InChI | InChI=1S/C24H24N2O2/c1-13(15(3)17(5)19(7)21(9)23(27)25-11)14(2)16(4)18(6)20(8)22(10)24(28)26-12/h1-12H2 |
| InChIKey | JNSGDDZSTJJPTL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|