C18H18N2O2 — CID 87087037
N,N',2,3,4,5,6,7,8-nonamethylidenenonanediamide (PubChem CID 87087037) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N,N',2,3,4,5,6,7,8-nonamethylidenenonanediamide.
| Compound Name | N,N',2,3,4,5,6,7,8-nonamethylidenenonanediamide |
|---|---|
| PubChem CID | 87087037 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N,N',2,3,4,5,6,7,8-nonamethylidenenonanediamide |
| SMILES | C=NC(=O)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=O)N=C |
| InChI | InChI=1S/C18H18N2O2/c1-10(11(2)13(4)15(6)17(21)19-8)12(3)14(5)16(7)18(22)20-9/h1-9H2 |
| InChIKey | SLYCUMHXAPRDPH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|