About (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide
(1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide (PubChem CID 158966140) has the molecular formula C21H34BrNO2
and a molecular weight of 412.41 g/mol. Its IUPAC name is (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide.
Molecular Properties
| Compound Name | (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide |
| PubChem CID | 158966140 |
| Molecular Formula | C21H34BrNO2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide |
| SMILES | C=CC(=O)Oc1cccc[n+]1CCCCCCCCCCCCC.[Br-] |
| InChI | InChI=1S/C21H34NO2.BrH/c1-3-5-6-7-8-9-10-11-12-13-15-18-22-19-16-14-17-20(22)24-21(23)4-2;/h4,14,16-17,19H,2-3,5-13,15,18H2,1H3;1H/q+1;/p-1 |
| InChIKey | JZCDBWLPRHUSNO-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide?
The IUPAC name of (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide (CID 158966140) is (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide.
What is the SMILES notation for (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide?
The canonical SMILES for (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide is C=CC(=O)Oc1cccc[n+]1CCCCCCCCCCCCC.[Br-].
What is the InChIKey of (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide?
The InChIKey is JZCDBWLPRHUSNO-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H34NO2.BrH/c1-3-5-6-7-8-9-10-11-12-13-15-18-22-19-16-14-17-20(22)24-21(23)4-2;/h4,14,16-17,19H,2-3,5-13,15,18H2,1H3;1H/q+1;/p-1.
What are the key properties of (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide?
(1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide has a molecular weight of 412.41 g/mol, XLogP of 2.38, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tridecylpyridin-1-ium-2-yl) prop-2-enoate bromide is sourced from PubChem (CID 158966140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).