C40H48N2O4S2 — CID 158966160
8-[[11-(2,5-dioxopyrrol-1-yl)-8-oxoundecyl]disulfanyl]-N-(pyren-1-ylmethyl)octanamide (PubChem CID 158966160) has the molecular formula C40H48N2O4S2 and a molecular weight of 684.97 g/mol. Its IUPAC name is 8-[[11-(2,5-dioxopyrrol-1-yl)-8-oxoundecyl]disulfanyl]-N-(pyren-1-ylmethyl)octanamide.
| Compound Name | 8-[[11-(2,5-dioxopyrrol-1-yl)-8-oxoundecyl]disulfanyl]-N-(pyren-1-ylmethyl)octanamide |
|---|---|
| PubChem CID | 158966160 |
| Molecular Formula | C40H48N2O4S2 |
| Molecular Weight | 684.97 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | 8-[[11-(2,5-dioxopyrrol-1-yl)-8-oxoundecyl]disulfanyl]-N-(pyren-1-ylmethyl)octanamide |
| SMILES | O=C(CCCCCCCSSCCCCCCCC(=O)NCc1ccc2ccc3cccc4ccc1c2c34)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C40H48N2O4S2/c43-34(16-12-26-42-37(45)24-25-38(42)46)15-7-3-1-5-9-27-47-48-28-10-6-2-4-8-17-36(44)41-29-33-21-20-32-19-18-30-13-11-14-31-22-23-35(33)40(32)39(30)31/h11,13-14,18-25H,1-10,12,15-17,26-29H2,(H,41,44) |
| InChIKey | JNFPIAIKFFQXOH-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.97 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|