C28H26ClIN8O — CID 158971111
2-chloro-7-[1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine;2-iodo-7-(1H-pyrazol-4-yl)-1,5-naphthyridine;methane (PubChem CID 158971111) has the molecular formula C28H26ClIN8O and a molecular weight of 652.93 g/mol. Its IUPAC name is 2-chloro-7-[1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine;2-iodo-7-(1H-pyrazol-4-yl)-1,5-naphthyridine;methane.
| Compound Name | 2-chloro-7-[1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine;2-iodo-7-(1H-pyrazol-4-yl)-1,5-naphthyridine;methane |
|---|---|
| PubChem CID | 158971111 |
| Molecular Formula | C28H26ClIN8O |
| Molecular Weight | 652.93 g/mol |
| Exact Mass | 652.10 |
| IUPAC Name | 2-chloro-7-[1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine;2-iodo-7-(1H-pyrazol-4-yl)-1,5-naphthyridine;methane |
| SMILES | C.Clc1ccc2ncc(-c3cnn(C4CCCCO4)c3)cc2n1.Ic1ccc2ncc(-c3cn[nH]c3)cc2n1 |
| InChI | InChI=1S/C16H15ClN4O.C11H7IN4.CH4/c17-15-5-4-13-14(20-15)7-11(8-18-13)12-9-19-21(10-12)16-3-1-2-6-22-16;12-11-2-1-9-10(16-11)3-7(4-13-9)8-5-14-15-6-8;/h4-5,7-10,16H,1-3,6H2;1-6H,(H,14,15);1H4 |
| InChIKey | JNVGDOSGMDZUEV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.93 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|