C31H34BN6O6 — CID 158972808
CID 158972808 (PubChem CID 158972808) has the molecular formula C31H34BN6O6 and a molecular weight of 597.46 g/mol.
| Compound Name | CID 158972808 |
|---|---|
| PubChem CID | 158972808 |
| Molecular Formula | C31H34BN6O6 |
| Molecular Weight | 597.46 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)n1c(O[B]O)cc2cccnc21.CC(C)(C)OC(=O)n1ccc2cccnc21.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C12H14BN2O4.C12H14N2O2.C7H6N2/c1-12(2,3)18-11(16)15-9(19-13-17)7-8-5-4-6-14-10(8)15;1-12(2,3)16-11(15)14-8-6-9-5-4-7-13-10(9)14;1-2-6-3-5-9-7(6)8-4-1/h4-7,17H,1-3H3;4-8H,1-3H3;1-5H,(H,8,9) |
| InChIKey | QIDNYTQGKBFLMY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|