C24H31N3O4 — CID 158975566
(2S)-1-[(2R)-2-cyclohexyl-4-oxopentanoyl]-N-(4-ethanimidoylbenzoyl)azetidine-2-carboxamide (PubChem CID 158975566) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-cyclohexyl-4-oxopentanoyl]-N-(4-ethanimidoylbenzoyl)azetidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-cyclohexyl-4-oxopentanoyl]-N-(4-ethanimidoylbenzoyl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 158975566 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (2S)-1-[(2R)-2-cyclohexyl-4-oxopentanoyl]-N-(4-ethanimidoylbenzoyl)azetidine-2-carboxamide |
| SMILES | [H]/N=C(\C)c1ccc(C(=O)NC(=O)[C@@H]2CCN2C(=O)[C@H](CC(C)=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-15(28)14-20(18-6-4-3-5-7-18)24(31)27-13-12-21(27)23(30)26-22(29)19-10-8-17(9-11-19)16(2)25/h8-11,18,20-21,25H,3-7,12-14H2,1-2H3,(H,26,29,30)/b25-16+/t20-,21+/m1/s1 |
| InChIKey | MJJSJKIVCDDWFW-JLNLYDCYSA-N |
| XLogP | 3.11 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|