C25H35N5O6 — CID 134990660
1-[(Z)-[amino-[4-[[[(2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamoyl]oxyethyl acetate (PubChem CID 134990660) has the molecular formula C25H35N5O6 and a molecular weight of 501.58 g/mol. Its IUPAC name is 1-[(Z)-[amino-[4-[[[(2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamoyl]oxyethyl acetate.
| Compound Name | 1-[(Z)-[amino-[4-[[[(2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamoyl]oxyethyl acetate |
|---|---|
| PubChem CID | 134990660 |
| Molecular Formula | C25H35N5O6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 1-[(Z)-[amino-[4-[[[(2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamoyl]oxyethyl acetate |
| SMILES | CC(=O)OC(C)OC(=O)/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCN2C(=O)[C@H](N)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H35N5O6/c1-15(31)35-16(2)36-25(34)29-22(27)19-10-8-17(9-11-19)14-28-23(32)20-12-13-30(20)24(33)21(26)18-6-4-3-5-7-18/h8-11,16,18,20-21H,3-7,12-14,26H2,1-2H3,(H,28,32)(H2,27,29,34)/t16?,20-,21+/m0/s1 |
| InChIKey | MPUBVHMOPRYLKY-KCECWRNFSA-N |
| XLogP | 1.56 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|