C18H23N5O4 — CID 175133817
[amino-[4-[[[(2S)-1-[(2R)-pyrrolidine-2-carbonyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamic acid (PubChem CID 175133817) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is [amino-[4-[[[(2S)-1-[(2R)-pyrrolidine-2-carbonyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamic acid.
| Compound Name | [amino-[4-[[[(2S)-1-[(2R)-pyrrolidine-2-carbonyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 175133817 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | [amino-[4-[[[(2S)-1-[(2R)-pyrrolidine-2-carbonyl]azetidine-2-carbonyl]amino]methyl]phenyl]methylidene]carbamic acid |
| SMILES | NC(=NC(=O)O)c1ccc(CNC(=O)[C@@H]2CCN2C(=O)[C@H]2CCCN2)cc1 |
| InChI | InChI=1S/C18H23N5O4/c19-15(22-18(26)27)12-5-3-11(4-6-12)10-21-16(24)14-7-9-23(14)17(25)13-2-1-8-20-13/h3-6,13-14,20H,1-2,7-10H2,(H2,19,22)(H,21,24)(H,26,27)/t13-,14+/m1/s1 |
| InChIKey | VOZYELAWYXGNRM-KGLIPLIRSA-N |
| XLogP | 0.04 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|