C27H39N5O5 — CID 88927838
(2S)-1-[2-cyclopentyl-3-[formyl(hydroxy)amino]propanoyl]-N-[4-(4-ethylpiperazin-1-yl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 88927838) has the molecular formula C27H39N5O5 and a molecular weight of 513.64 g/mol. Its IUPAC name is (2S)-1-[2-cyclopentyl-3-[formyl(hydroxy)amino]propanoyl]-N-[4-(4-ethylpiperazin-1-yl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-cyclopentyl-3-[formyl(hydroxy)amino]propanoyl]-N-[4-(4-ethylpiperazin-1-yl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 88927838 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | (2S)-1-[2-cyclopentyl-3-[formyl(hydroxy)amino]propanoyl]-N-[4-(4-ethylpiperazin-1-yl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCN1CCN(c2ccc(C(=O)NC(=O)[C@@H]3CCCN3C(=O)C(CN(O)C=O)C3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C27H39N5O5/c1-2-29-14-16-30(17-15-29)22-11-9-21(10-12-22)25(34)28-26(35)24-8-5-13-32(24)27(36)23(18-31(37)19-33)20-6-3-4-7-20/h9-12,19-20,23-24,37H,2-8,13-18H2,1H3,(H,28,34,35)/t23?,24-/m0/s1 |
| InChIKey | WCLZUFMFMIJWSQ-CGAIIQECSA-N |
| XLogP | 1.73 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|