C18H14N2O4S — CID 158979164
4-methoxy-3-(quinolin-8-ylsulfonylmethyl)-1,2-benzoxazole (PubChem CID 158979164) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is 4-methoxy-3-(quinolin-8-ylsulfonylmethyl)-1,2-benzoxazole.
| Compound Name | 4-methoxy-3-(quinolin-8-ylsulfonylmethyl)-1,2-benzoxazole |
|---|---|
| PubChem CID | 158979164 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 4-methoxy-3-(quinolin-8-ylsulfonylmethyl)-1,2-benzoxazole |
| SMILES | COc1cccc2onc(CS(=O)(=O)c3cccc4cccnc34)c12 |
| InChI | InChI=1S/C18H14N2O4S/c1-23-14-7-3-8-15-17(14)13(20-24-15)11-25(21,22)16-9-2-5-12-6-4-10-19-18(12)16/h2-10H,11H2,1H3 |
| InChIKey | JOTSMHNPMSDEAC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |