C19H20N2O4 — CID 158985413
1-[6-(5-hydroxypentoxy)quinolin-3-yl]pyridine-2,4-dione (PubChem CID 158985413) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[6-(5-hydroxypentoxy)quinolin-3-yl]pyridine-2,4-dione.
| Compound Name | 1-[6-(5-hydroxypentoxy)quinolin-3-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 158985413 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[6-(5-hydroxypentoxy)quinolin-3-yl]pyridine-2,4-dione |
| SMILES | O=C1C=CN(c2cnc3ccc(OCCCCCO)cc3c2)C(=O)C1 |
| InChI | InChI=1S/C19H20N2O4/c22-8-2-1-3-9-25-17-4-5-18-14(11-17)10-15(13-20-18)21-7-6-16(23)12-19(21)24/h4-7,10-11,13,22H,1-3,8-9,12H2 |
| InChIKey | ZKCKZROPXUTFSX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|