C14H18O14S — CID 158999056
(E)-but-2-enedioic acid;3-(2-carboxyethylsulfanyl)propanoic acid;(Z)-2,3-dihydroxybut-2-enedioic acid (PubChem CID 158999056) has the molecular formula C14H18O14S and a molecular weight of 442.35 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(2-carboxyethylsulfanyl)propanoic acid;(Z)-2,3-dihydroxybut-2-enedioic acid.
| Compound Name | (E)-but-2-enedioic acid;3-(2-carboxyethylsulfanyl)propanoic acid;(Z)-2,3-dihydroxybut-2-enedioic acid |
|---|---|
| PubChem CID | 158999056 |
| Molecular Formula | C14H18O14S |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(2-carboxyethylsulfanyl)propanoic acid;(Z)-2,3-dihydroxybut-2-enedioic acid |
| SMILES | O=C(O)/C(O)=C(/O)C(=O)O.O=C(O)/C=C/C(=O)O.O=C(O)CCSCCC(=O)O |
| InChI | InChI=1S/C6H10O4S.C4H4O6.C4H4O4/c7-5(8)1-3-11-4-2-6(9)10;5-1(3(7)8)2(6)4(9)10;5-3(6)1-2-4(7)8/h1-4H2,(H,7,8)(H,9,10);5-6H,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1-;2-1+ |
| InChIKey | WMBKGVYAPOZPRA-GAORIQBFSA-N |
| XLogP | -0.14 |
| TPSA | 264.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|