C27H27F3N4O5S — CID 159003086
tert-butyl 2-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]acetate (PubChem CID 159003086) has the molecular formula C27H27F3N4O5S and a molecular weight of 576.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]acetate.
| Compound Name | tert-butyl 2-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]acetate |
|---|---|
| PubChem CID | 159003086 |
| Molecular Formula | C27H27F3N4O5S |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | tert-butyl 2-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ccc(-c2ccc3nc(Nc4ccc(S(C)(=O)=O)cc4OCC(F)(F)F)nn3c2)cc1 |
| InChI | InChI=1S/C27H27F3N4O5S/c1-26(2,3)39-24(35)13-17-5-7-18(8-6-17)19-9-12-23-32-25(33-34(23)15-19)31-21-11-10-20(40(4,36)37)14-22(21)38-16-27(28,29)30/h5-12,14-15H,13,16H2,1-4H3,(H,31,33) |
| InChIKey | JRORVJSJMQWTHV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |