C31H26F4N4O4S — CID 153214259
(3R)-3-(4-fluorophenyl)-1-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]butan-2-one (PubChem CID 153214259) has the molecular formula C31H26F4N4O4S and a molecular weight of 626.63 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)-1-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]butan-2-one.
| Compound Name | (3R)-3-(4-fluorophenyl)-1-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]butan-2-one |
|---|---|
| PubChem CID | 153214259 |
| Molecular Formula | C31H26F4N4O4S |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)-1-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]butan-2-one |
| SMILES | C[C@@H](C(=O)Cc1ccc(-c2ccc3nc(Nc4ccc(S(C)(=O)=O)cc4OCC(F)(F)F)nn3c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H26F4N4O4S/c1-19(21-7-10-24(32)11-8-21)27(40)15-20-3-5-22(6-4-20)23-9-14-29-37-30(38-39(29)17-23)36-26-13-12-25(44(2,41)42)16-28(26)43-18-31(33,34)35/h3-14,16-17,19H,15,18H2,1-2H3,(H,36,38)/t19-/m1/s1 |
| InChIKey | WMJXULUNKKDITM-LJQANCHMSA-N |
| XLogP | 6.54 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |