C39H38N4O11 — CID 159005838
1-benzylpyrido[2,3-d][1,3]oxazine-2,4-dione;diethyl propanedioate;ethyl 1-benzyl-4-hydroxy-2-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 159005838) has the molecular formula C39H38N4O11 and a molecular weight of 738.75 g/mol. Its IUPAC name is 1-benzylpyrido[2,3-d][1,3]oxazine-2,4-dione;diethyl propanedioate;ethyl 1-benzyl-4-hydroxy-2-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | 1-benzylpyrido[2,3-d][1,3]oxazine-2,4-dione;diethyl propanedioate;ethyl 1-benzyl-4-hydroxy-2-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 159005838 |
| Molecular Formula | C39H38N4O11 |
| Molecular Weight | 738.75 g/mol |
| Exact Mass | 738.25 |
| IUPAC Name | 1-benzylpyrido[2,3-d][1,3]oxazine-2,4-dione;diethyl propanedioate;ethyl 1-benzyl-4-hydroxy-2-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)CC(=O)OCC.CCOC(=O)c1c(O)c2cccnc2n(Cc2ccccc2)c1=O.O=c1oc(=O)n(Cc2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C18H16N2O4.C14H10N2O3.C7H12O4/c1-2-24-18(23)14-15(21)13-9-6-10-19-16(13)20(17(14)22)11-12-7-4-3-5-8-12;17-13-11-7-4-8-15-12(11)16(14(18)19-13)9-10-5-2-1-3-6-10;1-3-10-6(8)5-7(9)11-4-2/h3-10,21H,2,11H2,1H3;1-8H,9H2;3-5H2,1-2H3 |
| InChIKey | JRXGQLSRHCGBFG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 199.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|