C21H46Br2N2O2 — CID 159013720
4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium dibromide (PubChem CID 159013720) has the molecular formula C21H46Br2N2O2 and a molecular weight of 518.42 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium dibromide.
| Compound Name | 4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium dibromide |
|---|---|
| PubChem CID | 159013720 |
| Molecular Formula | C21H46Br2N2O2 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium dibromide |
| SMILES | CC1(C)CC([N+](C)(C)CCCC[N+](C)(CCO)CCO)CC(C)(C)C1.[Br-].[Br-] |
| InChI | InChI=1S/C21H46N2O2.2BrH/c1-20(2)16-19(17-21(3,4)18-20)22(5,6)10-8-9-11-23(7,12-14-24)13-15-25;;/h19,24-25H,8-18H2,1-7H3;2*1H/q+2;;/p-2 |
| InChIKey | QXARTEIUFVPFOC-UHFFFAOYSA-L |
| XLogP | -3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|