C21H46N2O2+2 — CID 159013721
4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium (PubChem CID 159013721) has the molecular formula C21H46N2O2+2 and a molecular weight of 358.61 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium.
| Compound Name | 4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium |
|---|---|
| PubChem CID | 159013721 |
| Molecular Formula | C21H46N2O2+2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.35 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)-methylazaniumyl]butyl-dimethyl-(3,3,5,5-tetramethylcyclohexyl)azanium |
| SMILES | CC1(C)CC([N+](C)(C)CCCC[N+](C)(CCO)CCO)CC(C)(C)C1 |
| InChI | InChI=1S/C21H46N2O2/c1-20(2)16-19(17-21(3,4)18-20)22(5,6)10-8-9-11-23(7,12-14-24)13-15-25/h19,24-25H,8-18H2,1-7H3/q+2 |
| InChIKey | JSUZASBUNDYWDZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|