C17H36BrN2O3+ — CID 87691550
(1-bromo-2,2,6,6-tetramethylpiperidin-4-yl)-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-dimethylazanium (PubChem CID 87691550) has the molecular formula C17H36BrN2O3+ and a molecular weight of 396.39 g/mol. Its IUPAC name is (1-bromo-2,2,6,6-tetramethylpiperidin-4-yl)-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-dimethylazanium.
| Compound Name | (1-bromo-2,2,6,6-tetramethylpiperidin-4-yl)-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 87691550 |
| Molecular Formula | C17H36BrN2O3+ |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (1-bromo-2,2,6,6-tetramethylpiperidin-4-yl)-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-dimethylazanium |
| SMILES | CC1(C)CC([N+](C)(C)CCOCCOCCO)CC(C)(C)N1Br |
| InChI | InChI=1S/C17H36BrN2O3/c1-16(2)13-15(14-17(3,4)19(16)18)20(5,6)7-9-22-11-12-23-10-8-21/h15,21H,7-14H2,1-6H3/q+1 |
| InChIKey | KBTOQSWEZYXYRM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|