C17H39N3O+2 — CID 134338102
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-dimethyl-[3-(trimethylazaniumyl)propyl]azanium (PubChem CID 134338102) has the molecular formula C17H39N3O+2 and a molecular weight of 301.52 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-dimethyl-[3-(trimethylazaniumyl)propyl]azanium.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-dimethyl-[3-(trimethylazaniumyl)propyl]azanium |
|---|---|
| PubChem CID | 134338102 |
| Molecular Formula | C17H39N3O+2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.31 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-dimethyl-[3-(trimethylazaniumyl)propyl]azanium |
| SMILES | CC1(C)CC([N+](C)(C)CCC[N+](C)(C)C)CC(C)(C)N1O |
| InChI | InChI=1S/C17H39N3O/c1-16(2)13-15(14-17(3,4)18(16)21)20(8,9)12-10-11-19(5,6)7/h15,21H,10-14H2,1-9H3/q+2 |
| InChIKey | URFVHWTWOWNPNF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|