C25H53N4O2+2 — CID 166570488
CID 166570488 (PubChem CID 166570488) has the molecular formula C25H53N4O2+2 and a molecular weight of 441.73 g/mol.
| Compound Name | CID 166570488 |
|---|---|
| PubChem CID | 166570488 |
| Molecular Formula | C25H53N4O2+2 |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 441.42 |
| IUPAC Name | — |
| SMILES | CC1(C)CC([N+](C)(C)CCC[N+](C)(C)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C25H53N4O2/c1-22(2)16-20(17-23(3,4)26(22)30)28(9,10)14-13-15-29(11,12)21-18-24(5,6)27(31)25(7,8)19-21/h20-21,30H,13-19H2,1-12H3/q+2 |
| InChIKey | NBDZWQXHGNBHCB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|