About CID 166570488
CID 166570488 (PubChem CID 166570488) has the molecular formula C25H53N4O2+2
and a molecular weight of 441.73 g/mol.
Molecular Properties
| Compound Name | CID 166570488 |
| PubChem CID | 166570488 |
| Molecular Formula | C25H53N4O2+2 |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 441.42 |
| IUPAC Name | — |
| SMILES | CC1(C)CC([N+](C)(C)CCC[N+](C)(C)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C25H53N4O2/c1-22(2)16-20(17-23(3,4)26(22)30)28(9,10)14-13-15-29(11,12)21-18-24(5,6)27(31)25(7,8)19-21/h20-21,30H,13-19H2,1-12H3/q+2 |
| InChIKey | NBDZWQXHGNBHCB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 166570488 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166570488?
The IUPAC name of CID 166570488 (CID 166570488) is not available.
What is the SMILES notation for CID 166570488?
The canonical SMILES for CID 166570488 is CC1(C)CC([N+](C)(C)CCC[N+](C)(C)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O].
What is the InChIKey of CID 166570488?
The InChIKey is NBDZWQXHGNBHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H53N4O2/c1-22(2)16-20(17-23(3,4)26(22)30)28(9,10)14-13-15-29(11,12)21-18-24(5,6)27(31)25(7,8)19-21/h20-21,30H,13-19H2,1-12H3/q+2.
What are the key properties of CID 166570488?
CID 166570488 has a molecular weight of 441.73 g/mol, XLogP of 4.31, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166570488 is sourced from PubChem (CID 166570488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).