C39H48N10O6 — CID 159017765
methane;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;5-methyl-6-[(3,4,5-trimethoxyphenyl)iminomethyl]quinazoline-2,4-diamine (PubChem CID 159017765) has the molecular formula C39H48N10O6 and a molecular weight of 752.88 g/mol. Its IUPAC name is methane;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;5-methyl-6-[(3,4,5-trimethoxyphenyl)iminomethyl]quinazoline-2,4-diamine.
| Compound Name | methane;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;5-methyl-6-[(3,4,5-trimethoxyphenyl)iminomethyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 159017765 |
| Molecular Formula | C39H48N10O6 |
| Molecular Weight | 752.88 g/mol |
| Exact Mass | 752.38 |
| IUPAC Name | methane;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;5-methyl-6-[(3,4,5-trimethoxyphenyl)iminomethyl]quinazoline-2,4-diamine |
| SMILES | C.COc1cc(/N=C/c2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC.COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H23N5O3.C19H21N5O3.CH4/c2*1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3;/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24);5-9H,1-4H3,(H4,20,21,23,24);1H4/b;22-9+; |
| InChIKey | JTHPFXMIXXBITP-KAKGDTMQSA-N |
| XLogP | 6.26 |
| TPSA | 235.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.88 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|