C27H30O3 — CID 159025688
4-[cyclohexyl-bis(3-hydroxyphenyl)methyl]-2,6-dimethylphenol (PubChem CID 159025688) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is 4-[cyclohexyl-bis(3-hydroxyphenyl)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[cyclohexyl-bis(3-hydroxyphenyl)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 159025688 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-[cyclohexyl-bis(3-hydroxyphenyl)methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C(c2cccc(O)c2)(c2cccc(O)c2)C2CCCCC2)cc(C)c1O |
| InChI | InChI=1S/C27H30O3/c1-18-14-23(15-19(2)26(18)30)27(20-8-4-3-5-9-20,21-10-6-12-24(28)16-21)22-11-7-13-25(29)17-22/h6-7,10-17,20,28-30H,3-5,8-9H2,1-2H3 |
| InChIKey | JUGDTICDMPYNPO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|