C34H42O3 — CID 139978853
2-cyclohexyl-4-[1-(5-cyclohexyl-4-hydroxy-2-methylphenyl)-1-(3-hydroxyphenyl)ethyl]-5-methylphenol (PubChem CID 139978853) has the molecular formula C34H42O3 and a molecular weight of 498.71 g/mol. Its IUPAC name is 2-cyclohexyl-4-[1-(5-cyclohexyl-4-hydroxy-2-methylphenyl)-1-(3-hydroxyphenyl)ethyl]-5-methylphenol.
| Compound Name | 2-cyclohexyl-4-[1-(5-cyclohexyl-4-hydroxy-2-methylphenyl)-1-(3-hydroxyphenyl)ethyl]-5-methylphenol |
|---|---|
| PubChem CID | 139978853 |
| Molecular Formula | C34H42O3 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 2-cyclohexyl-4-[1-(5-cyclohexyl-4-hydroxy-2-methylphenyl)-1-(3-hydroxyphenyl)ethyl]-5-methylphenol |
| SMILES | Cc1cc(O)c(C2CCCCC2)cc1C(C)(c1cccc(O)c1)c1cc(C2CCCCC2)c(O)cc1C |
| InChI | InChI=1S/C34H42O3/c1-22-17-32(36)28(24-11-6-4-7-12-24)20-30(22)34(3,26-15-10-16-27(35)19-26)31-21-29(33(37)18-23(31)2)25-13-8-5-9-14-25/h10,15-21,24-25,35-37H,4-9,11-14H2,1-3H3 |
| InChIKey | GTEWODUJXPHFNH-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|