C10H14CrO2 — CID 15902808
[methoxy-(7-methyl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]chromium (PubChem CID 15902808) has the molecular formula C10H14CrO2 and a molecular weight of 218.22 g/mol. Its IUPAC name is [methoxy-(7-methyl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]chromium.
| Compound Name | [methoxy-(7-methyl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]chromium |
|---|---|
| PubChem CID | 15902808 |
| Molecular Formula | C10H14CrO2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | [methoxy-(7-methyl-2-oxabicyclo[4.2.0]oct-7-en-8-yl)methylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C)C2CCCOC12 |
| InChI | InChI=1S/C10H14O2.Cr/c1-7-8-4-3-5-12-10(8)9(7)6-11-2;/h8,10H,3-5H2,1-2H3; |
| InChIKey | RUBBWTUOFBZXBV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |