C15H20CrO2 — CID 135002849
[[7-(cyclohexen-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium (PubChem CID 135002849) has the molecular formula C15H20CrO2 and a molecular weight of 284.32 g/mol. Its IUPAC name is [[7-(cyclohexen-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium.
| Compound Name | [[7-(cyclohexen-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium |
|---|---|
| PubChem CID | 135002849 |
| Molecular Formula | C15H20CrO2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [[7-(cyclohexen-1-yl)-2-oxabicyclo[4.2.0]oct-7-en-8-yl]-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C2=CCCCC2)C2CCCOC12 |
| InChI | InChI=1S/C15H20O2.Cr/c1-16-10-13-14(11-6-3-2-4-7-11)12-8-5-9-17-15(12)13;/h6,12,15H,2-5,7-9H2,1H3; |
| InChIKey | IMDGTSKDJRLHPV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |