C30H42F6O2 — CID 163780146
5-ethyl-2-[4-[(E,5S)-7-[(1S)-3-ethyl-4,5-difluorocyclooct-3-en-1-yl]oxy-1,5,7,7-tetrafluorohept-3-en-3-yl]cyclohexa-1,3-dien-1-yl]oxane (PubChem CID 163780146) has the molecular formula C30H42F6O2 and a molecular weight of 548.65 g/mol. Its IUPAC name is 5-ethyl-2-[4-[(E,5S)-7-[(1S)-3-ethyl-4,5-difluorocyclooct-3-en-1-yl]oxy-1,5,7,7-tetrafluorohept-3-en-3-yl]cyclohexa-1,3-dien-1-yl]oxane.
| Compound Name | 5-ethyl-2-[4-[(E,5S)-7-[(1S)-3-ethyl-4,5-difluorocyclooct-3-en-1-yl]oxy-1,5,7,7-tetrafluorohept-3-en-3-yl]cyclohexa-1,3-dien-1-yl]oxane |
|---|---|
| PubChem CID | 163780146 |
| Molecular Formula | C30H42F6O2 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 5-ethyl-2-[4-[(E,5S)-7-[(1S)-3-ethyl-4,5-difluorocyclooct-3-en-1-yl]oxy-1,5,7,7-tetrafluorohept-3-en-3-yl]cyclohexa-1,3-dien-1-yl]oxane |
| SMILES | CCC1=C(F)C(F)CCC[C@H](OC(F)(F)C[C@H](F)/C=C(\CCF)C2=CC=C(C3CCC(CC)CO3)CC2)C1 |
| InChI | InChI=1S/C30H42F6O2/c1-3-20-8-13-28(37-19-20)23-11-9-22(10-12-23)24(14-15-31)16-25(32)18-30(35,36)38-26-6-5-7-27(33)29(34)21(4-2)17-26/h9,11,16,20,25-28H,3-8,10,12-15,17-19H2,1-2H3/b24-16+,29-21?/t20?,25-,26+,27?,28?/m1/s1 |
| InChIKey | MNXGFNCALLYBTB-XLHZCSSDSA-N |
| XLogP | 9.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |