C12H18O2 — CID 101051436
8-(methoxymethyl)-7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-ene (PubChem CID 101051436) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 8-(methoxymethyl)-7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-ene.
| Compound Name | 8-(methoxymethyl)-7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-ene |
|---|---|
| PubChem CID | 101051436 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 8-(methoxymethyl)-7-prop-1-en-2-yl-2-oxabicyclo[4.2.0]oct-7-ene |
| SMILES | C=C(C)C1=C(COC)C2OCCCC12 |
| InChI | InChI=1S/C12H18O2/c1-8(2)11-9-5-4-6-14-12(9)10(11)7-13-3/h9,12H,1,4-7H2,2-3H3 |
| InChIKey | NUFCCEKDWBHUJA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |