C22H26F4N2O2 — CID 159033825
6-[[(1S,2S)-2-[3-[3-fluoro-5-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]methyl]-4-methylpyridin-2-amine (PubChem CID 159033825) has the molecular formula C22H26F4N2O2 and a molecular weight of 426.45 g/mol. Its IUPAC name is 6-[[(1S,2S)-2-[3-[3-fluoro-5-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]methyl]-4-methylpyridin-2-amine.
| Compound Name | 6-[[(1S,2S)-2-[3-[3-fluoro-5-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]methyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 159033825 |
| Molecular Formula | C22H26F4N2O2 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 6-[[(1S,2S)-2-[3-[3-fluoro-5-(trifluoromethyl)phenoxy]propoxy]cyclopentyl]methyl]-4-methylpyridin-2-amine |
| SMILES | Cc1cc(N)nc(C[C@@H]2CCC[C@@H]2OCCCOc2cc(F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H26F4N2O2/c1-14-8-18(28-21(27)9-14)10-15-4-2-5-20(15)30-7-3-6-29-19-12-16(22(24,25)26)11-17(23)13-19/h8-9,11-13,15,20H,2-7,10H2,1H3,(H2,27,28)/t15-,20-/m0/s1 |
| InChIKey | RPZQISSYKPIMFP-YWZLYKJASA-N |
| XLogP | 5.33 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|