C37H47BF2N4NaO8P — CID 159034545
CID 159034545 (PubChem CID 159034545) has the molecular formula C37H47BF2N4NaO8P and a molecular weight of 778.58 g/mol.
| Compound Name | CID 159034545 |
|---|---|
| PubChem CID | 159034545 |
| Molecular Formula | C37H47BF2N4NaO8P |
| Molecular Weight | 778.58 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | — |
| SMILES | CC(C)OC(=O)[C@@H](C)CP(=O)(CCN1CCC[C@]2(C)C(=O)c3c(O)c(=O)c(C(=O)NCc4ccc(F)cc4F)cn3C[C@H]12)Oc1ccccc1.C[B-]N.[Na+] |
| InChI | InChI=1S/C36H42F2N3O8P.CH5BN.Na/c1-22(2)48-35(46)23(3)21-50(47,49-26-9-6-5-7-10-26)16-15-40-14-8-13-36(4)29(40)20-41-19-27(31(42)32(43)30(41)33(36)44)34(45)39-18-24-11-12-25(37)17-28(24)38;1-2-3;/h5-7,9-12,17,19,22-23,29,43H,8,13-16,18,20-21H2,1-4H3,(H,39,45);3H2,1H3;/q;-1;+1/t23-,29-,36-,50?;;/m0../s1 |
| InChIKey | YSMKQHIZRVBZJW-JBGVMUDMSA-N |
| XLogP | 1.99 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|