C21H23BF3N2S — CID 159037299
CID 159037299 (PubChem CID 159037299) has the molecular formula C21H23BF3N2S and a molecular weight of 403.30 g/mol.
| Compound Name | CID 159037299 |
|---|---|
| PubChem CID | 159037299 |
| Molecular Formula | C21H23BF3N2S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | — |
| SMILES | CCc1cnc[nH]1.CSc1ccccc1[B]CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15BF3S.C5H8N2/c1-21-15-8-3-2-7-14(15)17-10-9-12-5-4-6-13(11-12)16(18,19)20;1-2-5-3-6-4-7-5/h2-8,11H,9-10H2,1H3;3-4H,2H2,1H3,(H,6,7) |
| InChIKey | VOPUHEBQODSZKO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|