C22H18F3N3O5 — CID 159040343
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-(trifluoromethyl)benzamide;methane (PubChem CID 159040343) has the molecular formula C22H18F3N3O5 and a molecular weight of 461.40 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-(trifluoromethyl)benzamide;methane.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-(trifluoromethyl)benzamide;methane |
|---|---|
| PubChem CID | 159040343 |
| Molecular Formula | C22H18F3N3O5 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]-2-(trifluoromethyl)benzamide;methane |
| SMILES | C.O=C1CCC(N2C(=O)c3cccc(NC(=O)c4ccccc4C(F)(F)F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H14F3N3O5.CH4/c22-21(23,24)12-6-2-1-4-10(12)17(29)25-13-7-3-5-11-16(13)20(32)27(19(11)31)14-8-9-15(28)26-18(14)30;/h1-7,14H,8-9H2,(H,25,29)(H,26,28,30);1H4 |
| InChIKey | JVYYARZYICWUML-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|